C22H20ClF3N4O5S — CID 75253944
N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide (PubChem CID 75253944) has the molecular formula C22H20ClF3N4O5S and a molecular weight of 544.94 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 75253944 |
| Molecular Formula | C22H20ClF3N4O5S |
| Molecular Weight | 544.94 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | N-[4-[3-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]-2-(1,3,6-trimethyl-2,4-dioxo-4a,7a-dihydrofuro[2,3-d]pyrimidin-5-yl)acetamide |
| SMILES | CC1=C(CC(=O)Nc2nc(-c3ccc(OCC(F)(F)F)c(Cl)c3)cs2)C2C(=O)N(C)C(=O)N(C)C2O1 |
| InChI | InChI=1S/C22H20ClF3N4O5S/c1-10-12(17-18(32)29(2)21(33)30(3)19(17)35-10)7-16(31)28-20-27-14(8-36-20)11-4-5-15(13(23)6-11)34-9-22(24,25)26/h4-6,8,17,19H,7,9H2,1-3H3,(H,27,28,31) |
| InChIKey | PPZJUPZCUBBPAC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |