C15H20FN3O — CID 75255281
N-[(2-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 75255281) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 75255281 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)C1NNC2CCCCC21 |
| InChI | InChI=1S/C15H20FN3O/c16-12-7-3-1-5-10(12)9-17-15(20)14-11-6-2-4-8-13(11)18-19-14/h1,3,5,7,11,13-14,18-19H,2,4,6,8-9H2,(H,17,20) |
| InChIKey | RPWPQZACAKCAMR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |