C21H26N3O6S+ — CID 75256009
2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 75256009) has the molecular formula C21H26N3O6S+ and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 75256009 |
| Molecular Formula | C21H26N3O6S+ |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | CCCCN1C(=O)C2SC=CC2=[N+](CC(=O)Nc2cc(OC)c(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C21H25N3O6S/c1-5-6-8-23-20(26)19-14(7-9-31-19)24(21(23)27)12-17(25)22-13-10-15(28-2)18(30-4)16(11-13)29-3/h7,9-11,19H,5-6,8,12H2,1-4H3/p+1 |
| InChIKey | KWYGSXNKLALOQT-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|