C32H32BrN3S — CID 75256689
11-methyl-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene;hydrobromide (PubChem CID 75256689) has the molecular formula C32H32BrN3S and a molecular weight of 570.60 g/mol. Its IUPAC name is 11-methyl-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene;hydrobromide.
| Compound Name | 11-methyl-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene;hydrobromide |
|---|---|
| PubChem CID | 75256689 |
| Molecular Formula | C32H32BrN3S |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | 11-methyl-6,8-bis(4-methylphenyl)-13-[(4-methylphenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene;hydrobromide |
| SMILES | Br.Cc1ccc(C=C2CN(C)CC3=C2N=C2SC=C(c4ccc(C)cc4)N2C3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H31N3S.BrH/c1-21-5-11-24(12-6-21)17-27-18-34(4)19-28-30(27)33-32-35(31(28)26-15-9-23(3)10-16-26)29(20-36-32)25-13-7-22(2)8-14-25;/h5-17,20,31H,18-19H2,1-4H3;1H |
| InChIKey | WULUSAOZTYEGKV-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |