C21H32N4O3S — CID 75256916
5-tert-butyl-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 75256916) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 5-tert-butyl-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 75256916 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 5-tert-butyl-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CC(C)(C)C1CCC2NNC(C(=O)Nc3ccc(N4CCCS4(=O)=O)cc3)C2C1 |
| InChI | InChI=1S/C21H32N4O3S/c1-21(2,3)14-5-10-18-17(13-14)19(24-23-18)20(26)22-15-6-8-16(9-7-15)25-11-4-12-29(25,27)28/h6-9,14,17-19,23-24H,4-5,10-13H2,1-3H3,(H,22,26) |
| InChIKey | PNAHPPIJKPYVLN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |