C16H24N4O3S — CID 75256994
N-(5-ethyl-4-methylpyrazolidin-3-yl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 75256994) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(5-ethyl-4-methylpyrazolidin-3-yl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-(5-ethyl-4-methylpyrazolidin-3-yl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 75256994 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(5-ethyl-4-methylpyrazolidin-3-yl)-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CCC1NNC(NS(=O)(=O)c2ccc(N3CCCC3=O)cc2)C1C |
| InChI | InChI=1S/C16H24N4O3S/c1-3-14-11(2)16(18-17-14)19-24(22,23)13-8-6-12(7-9-13)20-10-4-5-15(20)21/h6-9,11,14,16-19H,3-5,10H2,1-2H3 |
| InChIKey | FWQUFCZPFFOJMR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |