C19H25N5O — CID 75257558
5-propyl-N,N-bis(pyridin-3-ylmethyl)pyrazolidine-3-carboxamide (PubChem CID 75257558) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 5-propyl-N,N-bis(pyridin-3-ylmethyl)pyrazolidine-3-carboxamide.
| Compound Name | 5-propyl-N,N-bis(pyridin-3-ylmethyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75257558 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 5-propyl-N,N-bis(pyridin-3-ylmethyl)pyrazolidine-3-carboxamide |
| SMILES | CCCC1CC(C(=O)N(Cc2cccnc2)Cc2cccnc2)NN1 |
| InChI | InChI=1S/C19H25N5O/c1-2-5-17-10-18(23-22-17)19(25)24(13-15-6-3-8-20-11-15)14-16-7-4-9-21-12-16/h3-4,6-9,11-12,17-18,22-23H,2,5,10,13-14H2,1H3 |
| InChIKey | GFFZOGURBNWCHV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |