C22H34N4O2 — CID 75261427
2-[4-[[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl(methyl)amino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 75261427) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[4-[[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl(methyl)amino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl(methyl)amino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 75261427 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 2-[4-[[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl(methyl)amino]methyl]phenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | CN(Cc1ccc(OCC(=O)N2CCCC2)cc1)CC1NNC2CCCCC21 |
| InChI | InChI=1S/C22H34N4O2/c1-25(15-21-19-6-2-3-7-20(19)23-24-21)14-17-8-10-18(11-9-17)28-16-22(27)26-12-4-5-13-26/h8-11,19-21,23-24H,2-7,12-16H2,1H3 |
| InChIKey | ZKWIYLQORXFHMU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |