C22H30N4O2S — CID 7526173
N'-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N-[3-(dimethylamino)propyl]oxamide (PubChem CID 7526173) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is N'-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N-[3-(dimethylamino)propyl]oxamide.
| Compound Name | N'-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N-[3-(dimethylamino)propyl]oxamide |
|---|---|
| PubChem CID | 7526173 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N'-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N-[3-(dimethylamino)propyl]oxamide |
| SMILES | CN(C)CCCNC(=O)C(=O)NC[C@H](c1cccs1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H30N4O2S/c1-25(2)12-6-11-23-21(27)22(28)24-15-19(20-9-5-14-29-20)26-13-10-17-7-3-4-8-18(17)16-26/h3-5,7-9,14,19H,6,10-13,15-16H2,1-2H3,(H,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | CIMANHKBHZNKJX-LJQANCHMSA-N |
| XLogP | 2.03 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|