About 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide
2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide (PubChem CID 75269953) has the molecular formula C12H16N5O4S+
and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide |
| PubChem CID | 75269953 |
| Molecular Formula | C12H16N5O4S+ |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CC(=O)CSC1=[N+](CC(N)=O)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C12H15N5O4S/c1-6(18)5-22-11-14-9-8(17(11)4-7(13)19)10(20)16(3)12(21)15(9)2/h8H,4-5H2,1-3H3,(H-,13,19)/p+1 |
| InChIKey | BGQLKQLAWYCJPE-UHFFFAOYSA-O |
| XLogP | -1.53 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide?
The IUPAC name of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide (CID 75269953) is 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide.
What is the SMILES notation for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide?
The canonical SMILES for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide is CC(=O)CSC1=[N+](CC(N)=O)C2C(=O)N(C)C(=O)N(C)C2=N1.
What is the InChIKey of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide?
The InChIKey is BGQLKQLAWYCJPE-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H15N5O4S/c1-6(18)5-22-11-14-9-8(17(11)4-7(13)19)10(20)16(3)12(21)15(9)2/h8H,4-5H2,1-3H3,(H-,13,19)/p+1.
What are the key properties of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide?
2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide has a molecular weight of 326.36 g/mol, XLogP of -1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetamide is sourced from PubChem (CID 75269953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).