C22H24Cl2N4O2 — CID 75270685
2-chloro-N-[1-[5-(3-chlorophenyl)pyrazolidine-3-carbonyl]piperidin-4-yl]benzamide (PubChem CID 75270685) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 2-chloro-N-[1-[5-(3-chlorophenyl)pyrazolidine-3-carbonyl]piperidin-4-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[5-(3-chlorophenyl)pyrazolidine-3-carbonyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 75270685 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-chloro-N-[1-[5-(3-chlorophenyl)pyrazolidine-3-carbonyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)C2CC(c3cccc(Cl)c3)NN2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C22H24Cl2N4O2/c23-15-5-3-4-14(12-15)19-13-20(27-26-19)22(30)28-10-8-16(9-11-28)25-21(29)17-6-1-2-7-18(17)24/h1-7,12,16,19-20,26-27H,8-11,13H2,(H,25,29) |
| InChIKey | CRYSEBLALUEMKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |