C14H17N3O3S — CID 75273640
1-benzyl-7-methylsulfanyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d][1,3]oxazine-2,4-dione (PubChem CID 75273640) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-benzyl-7-methylsulfanyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d][1,3]oxazine-2,4-dione.
| Compound Name | 1-benzyl-7-methylsulfanyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 75273640 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-benzyl-7-methylsulfanyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d][1,3]oxazine-2,4-dione |
| SMILES | CSC1NCC2C(=O)OC(=O)N(Cc3ccccc3)C2N1 |
| InChI | InChI=1S/C14H17N3O3S/c1-21-13-15-7-10-11(16-13)17(14(19)20-12(10)18)8-9-5-3-2-4-6-9/h2-6,10-11,13,15-16H,7-8H2,1H3 |
| InChIKey | YVMYTRNEWKWVBY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|