C14H21ClO6P2 — CID 75274825
7-chloro-1,3-bis(dimethoxyphosphoryl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 75274825) has the molecular formula C14H21ClO6P2 and a molecular weight of 382.72 g/mol. Its IUPAC name is 7-chloro-1,3-bis(dimethoxyphosphoryl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-chloro-1,3-bis(dimethoxyphosphoryl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 75274825 |
| Molecular Formula | C14H21ClO6P2 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 7-chloro-1,3-bis(dimethoxyphosphoryl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COP(=O)(OC)C1Cc2ccc(Cl)cc2C(P(=O)(OC)OC)C1 |
| InChI | InChI=1S/C14H21ClO6P2/c1-18-22(16,19-2)12-7-10-5-6-11(15)8-13(10)14(9-12)23(17,20-3)21-4/h5-6,8,12,14H,7,9H2,1-4H3 |
| InChIKey | SXPYDPIEXVKJDF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|