C18H30N4O3 — CID 75274915
2-amino-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide (PubChem CID 75274915) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-amino-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide.
| Compound Name | 2-amino-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 75274915 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-amino-N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methylbutanamide |
| SMILES | CC(C)C1C=CC(=O)NCCC=CC(NC(=O)C(N)C(C)C)C(=O)N1 |
| InChI | InChI=1S/C18H30N4O3/c1-11(2)13-8-9-15(23)20-10-6-5-7-14(17(24)21-13)22-18(25)16(19)12(3)4/h5,7-9,11-14,16H,6,10,19H2,1-4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | RNZSTKKZPDEZCV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|