C26H35ClN6 — CID 75276096
N-[[3-chloro-5-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-propyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 75276096) has the molecular formula C26H35ClN6 and a molecular weight of 467.06 g/mol. Its IUPAC name is N-[[3-chloro-5-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-propyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-[[3-chloro-5-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-propyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 75276096 |
| Molecular Formula | C26H35ClN6 |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N-[[3-chloro-5-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl]-N-propyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CCCN(Cc1nc2cccc(N3CCCN(C)CC3)n2c1Cl)C1CCCc2cccnc21 |
| InChI | InChI=1S/C26H35ClN6/c1-3-14-32(22-10-4-8-20-9-6-13-28-25(20)22)19-21-26(27)33-23(29-21)11-5-12-24(33)31-16-7-15-30(2)17-18-31/h5-6,9,11-13,22H,3-4,7-8,10,14-19H2,1-2H3 |
| InChIKey | XCQJEEBKLYKPGX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 39.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |