C17H19ClO4 — CID 752773
(2S,3S,4R,5R)-2,4-diacetyl-3-(4-chlorophenyl)-5-hydroxy-5-methylcyclohexan-1-one (PubChem CID 752773) has the molecular formula C17H19ClO4 and a molecular weight of 322.79 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,4-diacetyl-3-(4-chlorophenyl)-5-hydroxy-5-methylcyclohexan-1-one.
| Compound Name | (2S,3S,4R,5R)-2,4-diacetyl-3-(4-chlorophenyl)-5-hydroxy-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 752773 |
| Molecular Formula | C17H19ClO4 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (2S,3S,4R,5R)-2,4-diacetyl-3-(4-chlorophenyl)-5-hydroxy-5-methylcyclohexan-1-one |
| SMILES | CC(=O)[C@H]1C(=O)C[C@@](C)(O)[C@H](C(C)=O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClO4/c1-9(19)14-13(21)8-17(3,22)16(10(2)20)15(14)11-4-6-12(18)7-5-11/h4-7,14-16,22H,8H2,1-3H3/t14-,15+,16+,17+/m0/s1 |
| InChIKey | VFCCNJCFFPULCZ-YLFCFFPRSA-N |
| XLogP | 2.56 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|