C18H18N5O2+ — CID 75277377
5-[(3,5-dimethoxyphenyl)methyl]-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine (PubChem CID 75277377) has the molecular formula C18H18N5O2+ and a molecular weight of 336.38 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)methyl]-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine.
| Compound Name | 5-[(3,5-dimethoxyphenyl)methyl]-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine |
|---|---|
| PubChem CID | 75277377 |
| Molecular Formula | C18H18N5O2+ |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)methyl]-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine |
| SMILES | COc1cc(Cc2nc3ccccc3c3nc(N)[nH][n+]23)cc(OC)c1 |
| InChI | InChI=1S/C18H17N5O2/c1-24-12-7-11(8-13(10-12)25-2)9-16-20-15-6-4-3-5-14(15)17-21-18(19)22-23(16)17/h3-8,10H,9H2,1-2H3,(H2,19,22)/p+1 |
| InChIKey | OOUWYRBLMZEUGI-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|