C17H14N5O2+ — CID 75277379
5-(1,3-benzodioxol-5-ylmethyl)-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine (PubChem CID 75277379) has the molecular formula C17H14N5O2+ and a molecular weight of 320.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine |
|---|---|
| PubChem CID | 75277379 |
| Molecular Formula | C17H14N5O2+ |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-3H-[1,2,4]triazolo[1,5-c]quinazolin-4-ium-2-amine |
| SMILES | Nc1nc2c3ccccc3nc(Cc3ccc4c(c3)OCO4)[n+]2[nH]1 |
| InChI | InChI=1S/C17H13N5O2/c18-17-20-16-11-3-1-2-4-12(11)19-15(22(16)21-17)8-10-5-6-13-14(7-10)24-9-23-13/h1-7H,8-9H2,(H2,18,21)/p+1 |
| InChIKey | GPDFQUXFCMBYJK-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|