About N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide
N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide (PubChem CID 75278615) has the molecular formula C15H18N4O2S
and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide.
Molecular Properties
| Compound Name | N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide |
| PubChem CID | 75278615 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide |
| SMILES | CC=CC(=O)NCCn1nc(-c2sc(C)nc2C)ccc1=O |
| InChI | InChI=1S/C15H18N4O2S/c1-4-5-13(20)16-8-9-19-14(21)7-6-12(18-19)15-10(2)17-11(3)22-15/h4-7H,8-9H2,1-3H3,(H,16,20) |
| InChIKey | PLHFLFOZIRVAHY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide?
The IUPAC name of N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide (CID 75278615) is N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide.
What is the SMILES notation for N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide?
The canonical SMILES for N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide is CC=CC(=O)NCCn1nc(-c2sc(C)nc2C)ccc1=O.
What is the InChIKey of N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide?
The InChIKey is PLHFLFOZIRVAHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2S/c1-4-5-13(20)16-8-9-19-14(21)7-6-12(18-19)15-10(2)17-11(3)22-15/h4-7H,8-9H2,1-3H3,(H,16,20).
What are the key properties of N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide?
N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide has a molecular weight of 318.40 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]but-2-enamide is sourced from PubChem (CID 75278615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).