C19H27N3O3 — CID 75279162
N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide (PubChem CID 75279162) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 75279162 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(3-ethyl-4-methyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide |
| SMILES | CCC1C(=O)NC2CC(NC(=O)c3cccn(C)c3=O)CCC2C1C |
| InChI | InChI=1S/C19H27N3O3/c1-4-13-11(2)14-8-7-12(10-16(14)21-17(13)23)20-18(24)15-6-5-9-22(3)19(15)25/h5-6,9,11-14,16H,4,7-8,10H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | NZQUXFMNFGMLDS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |