C20H29N3O3 — CID 75279671
N-(4-tert-butyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide (PubChem CID 75279671) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(4-tert-butyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-(4-tert-butyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 75279671 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(4-tert-butyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-1-methyl-2-oxopyridine-3-carboxamide |
| SMILES | Cn1cccc(C(=O)NC2CCC3C(C2)NC(=O)CC3C(C)(C)C)c1=O |
| InChI | InChI=1S/C20H29N3O3/c1-20(2,3)15-11-17(24)22-16-10-12(7-8-13(15)16)21-18(25)14-6-5-9-23(4)19(14)26/h5-6,9,12-13,15-16H,7-8,10-11H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | SMVMTTYWOSVDKS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |