C21H27N3O3 — CID 75279904
2-indol-1-yl-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]acetamide (PubChem CID 75279904) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-indol-1-yl-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]acetamide.
| Compound Name | 2-indol-1-yl-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]acetamide |
|---|---|
| PubChem CID | 75279904 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-indol-1-yl-N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]acetamide |
| SMILES | COCC1CC(=O)NC2CC(NC(=O)Cn3ccc4ccccc43)CCC12 |
| InChI | InChI=1S/C21H27N3O3/c1-27-13-15-10-20(25)23-18-11-16(6-7-17(15)18)22-21(26)12-24-9-8-14-4-2-3-5-19(14)24/h2-5,8-9,15-18H,6-7,10-13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | WVZHRFNTSSKEQG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |