C23H30N4O4 — CID 75280125
N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-3-(2-methoxyphenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 75280125) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-3-(2-methoxyphenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-3-(2-methoxyphenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 75280125 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[4-(methoxymethyl)-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl]-3-(2-methoxyphenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | COCC1CC(=O)NC2CC(NC(=O)c3cc(-c4ccccc4OC)nn3C)CCC12 |
| InChI | InChI=1S/C23H30N4O4/c1-27-20(12-19(26-27)17-6-4-5-7-21(17)31-3)23(29)24-15-8-9-16-14(13-30-2)10-22(28)25-18(16)11-15/h4-7,12,14-16,18H,8-11,13H2,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | AZUFQIKVIZQMKS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |