C24H33N3O3 — CID 75280567
1-(3,4-dimethylphenyl)-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 75280567) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75280567 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-(4-ethyl-2-oxo-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-7-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCC1CC(=O)NC2CC(NC(=O)C3CC(=O)N(c4ccc(C)c(C)c4)C3)CCC12 |
| InChI | InChI=1S/C24H33N3O3/c1-4-16-10-22(28)26-21-12-18(6-8-20(16)21)25-24(30)17-11-23(29)27(13-17)19-7-5-14(2)15(3)9-19/h5,7,9,16-18,20-21H,4,6,8,10-13H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | LJGRETCXSRLQNB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |