C28H31N5OSi — CID 75283060
2-[(4-methylpiperazin-1-yl)methylidene]-6-phenyl-8-(2-trimethylsilylethynyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one (PubChem CID 75283060) has the molecular formula C28H31N5OSi and a molecular weight of 481.68 g/mol. Its IUPAC name is 2-[(4-methylpiperazin-1-yl)methylidene]-6-phenyl-8-(2-trimethylsilylethynyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one.
| Compound Name | 2-[(4-methylpiperazin-1-yl)methylidene]-6-phenyl-8-(2-trimethylsilylethynyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 75283060 |
| Molecular Formula | C28H31N5OSi |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[(4-methylpiperazin-1-yl)methylidene]-6-phenyl-8-(2-trimethylsilylethynyl)-4H-imidazo[1,2-a][1,4]benzodiazepin-1-one |
| SMILES | CN1CCN(C=C2N=C3CN=C(c4ccccc4)c4cc(C#C[Si](C)(C)C)ccc4N3C2=O)CC1 |
| InChI | InChI=1S/C28H31N5OSi/c1-31-13-15-32(16-14-31)20-24-28(34)33-25-11-10-21(12-17-35(2,3)4)18-23(25)27(29-19-26(33)30-24)22-8-6-5-7-9-22/h5-11,18,20H,13-16,19H2,1-4H3 |
| InChIKey | LDUSWFYZCDZXLY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|