C14H15N5S — CID 752833
3-(1,5-dimethylpyrazol-3-yl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 752833) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-3-yl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,5-dimethylpyrazol-3-yl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 752833 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-3-yl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(-c3cc(C)n(C)n3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C14H15N5S/c1-9-4-6-11(7-5-9)19-13(15-16-14(19)20)12-8-10(2)18(3)17-12/h4-8H,1-3H3,(H,16,20) |
| InChIKey | NZFCGJMEAHDOGB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|