C23H26N3O4+ — CID 7528502
(5R)-4-amino-5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol (PubChem CID 7528502) has the molecular formula C23H26N3O4+ and a molecular weight of 408.48 g/mol. Its IUPAC name is (5R)-4-amino-5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol.
| Compound Name | (5R)-4-amino-5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
|---|---|
| PubChem CID | 7528502 |
| Molecular Formula | C23H26N3O4+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (5R)-4-amino-5-(3,4-dimethoxyphenyl)-3-(2-methylpropyl)-5H-chromeno[2,3-d]pyrimidin-3-ium-8-ol |
| SMILES | COc1ccc([C@@H]2c3ccc(O)cc3Oc3nc[n+](CC(C)C)c(N)c32)cc1OC |
| InChI | InChI=1S/C23H25N3O4/c1-13(2)11-26-12-25-23-21(22(26)24)20(16-7-6-15(27)10-18(16)30-23)14-5-8-17(28-3)19(9-14)29-4/h5-10,12-13,20,24,27H,11H2,1-4H3/p+1/t20-/m1/s1 |
| InChIKey | DILCSCGCUNLLKC-HXUWFJFHSA-O |
| XLogP | 3.62 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|