C13H13FN2O2S3 — CID 7528764
5-[[(4R)-1,3-dioxan-4-yl]methylsulfanyl]-3-(4-fluorophenyl)-1,3,4-thiadiazole-2-thione (PubChem CID 7528764) has the molecular formula C13H13FN2O2S3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-[[(4R)-1,3-dioxan-4-yl]methylsulfanyl]-3-(4-fluorophenyl)-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[[(4R)-1,3-dioxan-4-yl]methylsulfanyl]-3-(4-fluorophenyl)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 7528764 |
| Molecular Formula | C13H13FN2O2S3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 5-[[(4R)-1,3-dioxan-4-yl]methylsulfanyl]-3-(4-fluorophenyl)-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1ccc(-n2nc(SC[C@H]3CCOCO3)sc2=S)cc1 |
| InChI | InChI=1S/C13H13FN2O2S3/c14-9-1-3-10(4-2-9)16-13(19)21-12(15-16)20-7-11-5-6-17-8-18-11/h1-4,11H,5-8H2/t11-/m1/s1 |
| InChIKey | WTPKAWAVBWCQIJ-LLVKDONJSA-N |
| XLogP | 3.66 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|