C34H48O8 — CID 75288194
[15-(3-acetyloxy-7-hydroxy-6-methyl-5-methylidene-4-oxoheptan-2-yl)-9-hydroxy-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate (PubChem CID 75288194) has the molecular formula C34H48O8 and a molecular weight of 584.75 g/mol. Its IUPAC name is [15-(3-acetyloxy-7-hydroxy-6-methyl-5-methylidene-4-oxoheptan-2-yl)-9-hydroxy-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate.
| Compound Name | [15-(3-acetyloxy-7-hydroxy-6-methyl-5-methylidene-4-oxoheptan-2-yl)-9-hydroxy-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 75288194 |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [15-(3-acetyloxy-7-hydroxy-6-methyl-5-methylidene-4-oxoheptan-2-yl)-9-hydroxy-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
| SMILES | C=C(C(=O)C(OC(C)=O)C(C)C1C(OC(C)=O)CC2(C)C3CC(O)C4C(C)C(=O)C=CC45CC35CCC12C)C(C)CO |
| InChI | InChI=1S/C34H48O8/c1-17(15-35)18(2)29(40)30(42-22(6)37)20(4)28-25(41-21(5)36)14-32(8)26-13-24(39)27-19(3)23(38)9-10-34(27)16-33(26,34)12-11-31(28,32)7/h9-10,17,19-20,24-28,30,35,39H,2,11-16H2,1,3-8H3 |
| InChIKey | HEMHDIHNEPEXBX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|