C13H15F3N2O — CID 75288558
5,5-dimethyl-1-(2,2,2-trifluoro-1-phenylethyl)pyrazolidin-3-one (PubChem CID 75288558) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2,2,2-trifluoro-1-phenylethyl)pyrazolidin-3-one.
| Compound Name | 5,5-dimethyl-1-(2,2,2-trifluoro-1-phenylethyl)pyrazolidin-3-one |
|---|---|
| PubChem CID | 75288558 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5,5-dimethyl-1-(2,2,2-trifluoro-1-phenylethyl)pyrazolidin-3-one |
| SMILES | CC1(C)CC(=O)NN1C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O/c1-12(2)8-10(19)17-18(12)11(13(14,15)16)9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3,(H,17,19) |
| InChIKey | XVNOUKZWAPQHOK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |