C34H49O10P — CID 75288711
[15-(3-acetyloxy-6-methyl-5-methylidene-4-oxo-7-phosphonooxyheptan-2-yl)-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate (PubChem CID 75288711) has the molecular formula C34H49O10P and a molecular weight of 648.73 g/mol. Its IUPAC name is [15-(3-acetyloxy-6-methyl-5-methylidene-4-oxo-7-phosphonooxyheptan-2-yl)-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate.
| Compound Name | [15-(3-acetyloxy-6-methyl-5-methylidene-4-oxo-7-phosphonooxyheptan-2-yl)-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 75288711 |
| Molecular Formula | C34H49O10P |
| Molecular Weight | 648.73 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | [15-(3-acetyloxy-6-methyl-5-methylidene-4-oxo-7-phosphonooxyheptan-2-yl)-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
| SMILES | C=C(C(=O)C(OC(C)=O)C(C)C1C(OC(C)=O)CC2(C)C3CCC4C(C)C(=O)C=CC45CC35CCC12C)C(C)COP(=O)(O)O |
| InChI | InChI=1S/C34H49O10P/c1-18(16-42-45(39,40)41)19(2)29(38)30(44-23(6)36)21(4)28-26(43-22(5)35)15-32(8)27-10-9-24-20(3)25(37)11-12-33(24)17-34(27,33)14-13-31(28,32)7/h11-12,18,20-21,24,26-28,30H,2,9-10,13-17H2,1,3-8H3,(H2,39,40,41) |
| InChIKey | RPHAOFQBHXEBJL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|