C35H30F4N2O4S — CID 75289351
[5-[4-(1,1-difluoro-2-phenylethyl)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2-fluorophenyl)methanone (PubChem CID 75289351) has the molecular formula C35H30F4N2O4S and a molecular weight of 650.69 g/mol. Its IUPAC name is [5-[4-(1,1-difluoro-2-phenylethyl)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2-fluorophenyl)methanone.
| Compound Name | [5-[4-(1,1-difluoro-2-phenylethyl)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 75289351 |
| Molecular Formula | C35H30F4N2O4S |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | [5-[4-(1,1-difluoro-2-phenylethyl)-2-fluorophenyl]-10-hydroxy-2,2-dimethyl-4,4-dioxo-1,3,5,11-tetrahydrothiopyrano[2,3-c][1,5]benzodiazepin-6-yl]-(2-fluorophenyl)methanone |
| SMILES | CC1(C)CC2=C(C(c3ccc(C(F)(F)Cc4ccccc4)cc3F)N(C(=O)c3ccccc3F)c3cccc(O)c3N2)S(=O)(=O)C1 |
| InChI | InChI=1S/C35H30F4N2O4S/c1-34(2)19-27-32(46(44,45)20-34)31(23-16-15-22(17-26(23)37)35(38,39)18-21-9-4-3-5-10-21)41(28-13-8-14-29(42)30(28)40-27)33(43)24-11-6-7-12-25(24)36/h3-17,31,40,42H,18-20H2,1-2H3 |
| InChIKey | OUVRYHURJRADBQ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|