About (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate
(2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate (PubChem CID 752899) has the molecular formula C10H18N2OS2
and a molecular weight of 246.40 g/mol. Its IUPAC name is (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate |
| PubChem CID | 752899 |
| Molecular Formula | C10H18N2OS2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCN1CCCCCC1=O |
| InChI | InChI=1S/C10H18N2OS2/c1-11(2)10(14)15-8-12-7-5-3-4-6-9(12)13/h3-8H2,1-2H3 |
| InChIKey | GDKKITBJYULDPG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate?
The IUPAC name of (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate (CID 752899) is (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate.
What is the SMILES notation for (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate?
The canonical SMILES for (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate is CN(C)C(=S)SCN1CCCCCC1=O.
What is the InChIKey of (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate?
The InChIKey is GDKKITBJYULDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2OS2/c1-11(2)10(14)15-8-12-7-5-3-4-6-9(12)13/h3-8H2,1-2H3.
What are the key properties of (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate?
(2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate has a molecular weight of 246.40 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-1-yl)methyl N,N-dimethylcarbamodithioate is sourced from PubChem (CID 752899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).