C16H26N6O4 — CID 7529008
6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine (PubChem CID 7529008) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 7529008 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 6-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-4-amine |
| SMILES | C[C@@H]1CN(c2nc(N)c([N+](=O)[O-])c(N3C[C@H](C)O[C@@H](C)C3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H26N6O4/c1-9-5-20(6-10(2)25-9)15-13(22(23)24)14(17)18-16(19-15)21-7-11(3)26-12(4)8-21/h9-12H,5-8H2,1-4H3,(H2,17,18,19)/t9-,10-,11-,12+/m0/s1 |
| InChIKey | JLOPEXXOVOGYRH-FIQHERPVSA-N |
| XLogP | 1.19 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|