C21H19ClF3N5O2S — CID 75291481
6-(6-chloro-3-cyano-1-cyclopentylpyrrolo[3,2-c]pyridin-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide (PubChem CID 75291481) has the molecular formula C21H19ClF3N5O2S and a molecular weight of 497.93 g/mol. Its IUPAC name is 6-(6-chloro-3-cyano-1-cyclopentylpyrrolo[3,2-c]pyridin-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(6-chloro-3-cyano-1-cyclopentylpyrrolo[3,2-c]pyridin-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 75291481 |
| Molecular Formula | C21H19ClF3N5O2S |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 6-(6-chloro-3-cyano-1-cyclopentylpyrrolo[3,2-c]pyridin-2-yl)-N-(1,1,1-trifluoropropan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(-c2c(C#N)c3cnc(Cl)cc3n2C2CCCC2)nc1)C(F)(F)F |
| InChI | InChI=1S/C21H19ClF3N5O2S/c1-12(21(23,24)25)29-33(31,32)14-6-7-17(27-10-14)20-15(9-26)16-11-28-19(22)8-18(16)30(20)13-4-2-3-5-13/h6-8,10-13,29H,2-5H2,1H3 |
| InChIKey | HQWDFXZQSOTLCO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|