C17H20N4O5S — CID 7529178
N-(2-methoxy-5-nitrophenyl)-2-[(5R)-4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl]acetamide (PubChem CID 7529178) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-[(5R)-4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-[(5R)-4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 7529178 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-[(5R)-4-oxo-2-piperidin-1-yl-1,3-thiazol-5-yl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C[C@H]1SC(N2CCCCC2)=NC1=O |
| InChI | InChI=1S/C17H20N4O5S/c1-26-13-6-5-11(21(24)25)9-12(13)18-15(22)10-14-16(23)19-17(27-14)20-7-3-2-4-8-20/h5-6,9,14H,2-4,7-8,10H2,1H3,(H,18,22)/t14-/m1/s1 |
| InChIKey | LNCWMFWGJMUKRT-CQSZACIVSA-N |
| XLogP | 2.42 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|