C57H98O9 — CID 75293551
2,3-bis(13-hydroxyoctadeca-9,11-dienoyloxy)propyl 13-hydroxyoctadeca-9,11-dienoate (PubChem CID 75293551) has the molecular formula C57H98O9 and a molecular weight of 927.40 g/mol. Its IUPAC name is 2,3-bis(13-hydroxyoctadeca-9,11-dienoyloxy)propyl 13-hydroxyoctadeca-9,11-dienoate.
| Compound Name | 2,3-bis(13-hydroxyoctadeca-9,11-dienoyloxy)propyl 13-hydroxyoctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 75293551 |
| Molecular Formula | C57H98O9 |
| Molecular Weight | 927.40 g/mol |
| Exact Mass | 926.72 |
| IUPAC Name | 2,3-bis(13-hydroxyoctadeca-9,11-dienoyloxy)propyl 13-hydroxyoctadeca-9,11-dienoate |
| SMILES | CCCCCC(O)C=CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CC=CC(O)CCCCC)OC(=O)CCCCCCCC=CC=CC(O)CCCCC |
| InChI | InChI=1S/C57H98O9/c1-4-7-31-40-51(58)43-34-25-19-13-10-16-22-28-37-46-55(61)64-49-54(66-57(63)48-39-30-24-18-12-15-21-27-36-45-53(60)42-33-9-6-3)50-65-56(62)47-38-29-23-17-11-14-20-26-35-44-52(59)41-32-8-5-2/h19-21,25-27,34-36,43-45,51-54,58-60H,4-18,22-24,28-33,37-42,46-50H2,1-3H3 |
| InChIKey | QXZCUPOHWQDVQN-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.40 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|