C31H48ClN3O7 — CID 75297893
[7-chloro-1-[[2-[(9,13-dihydroxy-12-methoxy-6,8-dimethyltrideca-2,4,6,11-tetraenoyl)amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 75297893) has the molecular formula C31H48ClN3O7 and a molecular weight of 610.19 g/mol. Its IUPAC name is [7-chloro-1-[[2-[(9,13-dihydroxy-12-methoxy-6,8-dimethyltrideca-2,4,6,11-tetraenoyl)amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [7-chloro-1-[[2-[(9,13-dihydroxy-12-methoxy-6,8-dimethyltrideca-2,4,6,11-tetraenoyl)amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 75297893 |
| Molecular Formula | C31H48ClN3O7 |
| Molecular Weight | 610.19 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | [7-chloro-1-[[2-[(9,13-dihydroxy-12-methoxy-6,8-dimethyltrideca-2,4,6,11-tetraenoyl)amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | COC(=CCC(O)C(C)C=C(C)C=CC=CC(=O)NC(C(=O)NC=CCC(CC=C(C)Cl)OC(N)=O)C(C)(C)C)CO |
| InChI | InChI=1S/C31H48ClN3O7/c1-21(19-22(2)26(37)17-16-25(20-36)41-7)11-8-9-13-27(38)35-28(31(4,5)6)29(39)34-18-10-12-24(42-30(33)40)15-14-23(3)32/h8-11,13-14,16,18-19,22,24,26,28,36-37H,12,15,17,20H2,1-7H3,(H2,33,40)(H,34,39)(H,35,38) |
| InChIKey | CUXSQBDRKIHXBH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|