C24H22BrFN2O3S — CID 75299427
N-[[3-(4-bromophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 75299427) has the molecular formula C24H22BrFN2O3S and a molecular weight of 517.42 g/mol. Its IUPAC name is N-[[3-(4-bromophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[[3-(4-bromophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75299427 |
| Molecular Formula | C24H22BrFN2O3S |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | N-[[3-(4-bromophenyl)phenyl]methyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc(-c2ccc(Br)cc2)c1)C1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22BrFN2O3S/c25-20-8-6-18(7-9-20)19-4-1-3-17(15-19)16-27-24(29)23-5-2-14-28(23)32(30,31)22-12-10-21(26)11-13-22/h1,3-4,6-13,15,23H,2,5,14,16H2,(H,27,29) |
| InChIKey | FKBAZKVNCVOMIG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |