About ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate
ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate (PubChem CID 75300385) has the molecular formula C19H25NO3
and a molecular weight of 315.41 g/mol. Its IUPAC name is ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate |
| PubChem CID | 75300385 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate |
| SMILES | CCOC(=O)C12CCCC(CN(Cc3ccccc3)C1)C21CO1 |
| InChI | InChI=1S/C19H25NO3/c1-2-22-17(21)18-10-6-9-16(19(18)14-23-19)12-20(13-18)11-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14H2,1H3 |
| InChIKey | QPJYIADPBWTLGB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate?
The IUPAC name of ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate (CID 75300385) is ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate.
What is the SMILES notation for ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate?
The canonical SMILES for ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate is CCOC(=O)C12CCCC(CN(Cc3ccccc3)C1)C21CO1.
What is the InChIKey of ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate?
The InChIKey is QPJYIADPBWTLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO3/c1-2-22-17(21)18-10-6-9-16(19(18)14-23-19)12-20(13-18)11-15-7-4-3-5-8-15/h3-5,7-8,16H,2,6,9-14H2,1H3.
What are the key properties of ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate?
ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate has a molecular weight of 315.41 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzylspiro[3-azabicyclo[3.3.1]nonane-9,2'-oxirane]-1-carboxylate is sourced from PubChem (CID 75300385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).