C32H33N5O6 — CID 75302057
2-[3-(3-methoxyphenyl)-5-oxo-8,11-dioxa-1,4-diazaspiro[5.6]dodecan-4-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide (PubChem CID 75302057) has the molecular formula C32H33N5O6 and a molecular weight of 583.65 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-5-oxo-8,11-dioxa-1,4-diazaspiro[5.6]dodecan-4-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide.
| Compound Name | 2-[3-(3-methoxyphenyl)-5-oxo-8,11-dioxa-1,4-diazaspiro[5.6]dodecan-4-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide |
|---|---|
| PubChem CID | 75302057 |
| Molecular Formula | C32H33N5O6 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-5-oxo-8,11-dioxa-1,4-diazaspiro[5.6]dodecan-4-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)acetamide |
| SMILES | COc1cccc(C2CNC3(COCCOC3)C(=O)N2CC(=O)Nc2ccc3c(c2)CC2(C3)C(=O)Nc3ncccc32)c1 |
| InChI | InChI=1S/C32H33N5O6/c1-41-24-5-2-4-20(13-24)26-16-34-32(18-42-10-11-43-19-32)30(40)37(26)17-27(38)35-23-8-7-21-14-31(15-22(21)12-23)25-6-3-9-33-28(25)36-29(31)39/h2-9,12-13,26,34H,10-11,14-19H2,1H3,(H,35,38)(H,33,36,39) |
| InChIKey | XURJNJAHNLIGCM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |