About [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium
[(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium (PubChem CID 7530341) has the molecular formula C15H22N5O+
and a molecular weight of 288.37 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium.
Molecular Properties
| Compound Name | [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium |
| PubChem CID | 7530341 |
| Molecular Formula | C15H22N5O+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium |
| SMILES | C[NH2+][C@@]1(c2nnnn2-c2ccccc2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H21N5O/c1-14(2)11-15(16-3,9-10-21-14)13-17-18-19-20(13)12-7-5-4-6-8-12/h4-8,16H,9-11H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | AYFZWHGTBVLBLC-HNNXBMFYSA-O |
| XLogP | 0.64 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium?
The IUPAC name of [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium (CID 7530341) is [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium.
What is the SMILES notation for [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium?
The canonical SMILES for [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium is C[NH2+][C@@]1(c2nnnn2-c2ccccc2)CCOC(C)(C)C1.
What is the InChIKey of [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium?
The InChIKey is AYFZWHGTBVLBLC-HNNXBMFYSA-O. The full InChI is InChI=1S/C15H21N5O/c1-14(2)11-15(16-3,9-10-21-14)13-17-18-19-20(13)12-7-5-4-6-8-12/h4-8,16H,9-11H2,1-3H3/p+1/t15-/m0/s1.
What are the key properties of [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium?
[(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium has a molecular weight of 288.37 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)oxan-4-yl]-methylazanium is sourced from PubChem (CID 7530341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).