About methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate
methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate (PubChem CID 75303704) has the molecular formula C14H15FO5
and a molecular weight of 282.27 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate |
| PubChem CID | 75303704 |
| Molecular Formula | C14H15FO5 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(O)C=C(c2ccc(F)cc2)C(O)C(O)C1 |
| InChI | InChI=1S/C14H15FO5/c1-20-13(18)14(19)6-10(12(17)11(16)7-14)8-2-4-9(15)5-3-8/h2-6,11-12,16-17,19H,7H2,1H3 |
| InChIKey | OWBIULUZKNWCGM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate (CID 75303704) is methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate is COC(=O)C1(O)C=C(c2ccc(F)cc2)C(O)C(O)C1.
What is the InChIKey of methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate?
The InChIKey is OWBIULUZKNWCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FO5/c1-20-13(18)14(19)6-10(12(17)11(16)7-14)8-2-4-9(15)5-3-8/h2-6,11-12,16-17,19H,7H2,1H3.
What are the key properties of methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate?
methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate has a molecular weight of 282.27 g/mol, XLogP of 0.24, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-fluorophenyl)-1,4,5-trihydroxycyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 75303704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).