C21H26F3N5O2S — CID 75306311
3,3-dimethyl-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 75306311) has the molecular formula C21H26F3N5O2S and a molecular weight of 469.53 g/mol. Its IUPAC name is 3,3-dimethyl-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | 3,3-dimethyl-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 75306311 |
| Molecular Formula | C21H26F3N5O2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3,3-dimethyl-1-N-[4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)-4-pyridinyl]-1,3-thiazol-2-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1nc(NC(=O)N2CCC(C)(C)C2C(N)=O)sc1-c1ccnc(C(C)(C)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H26F3N5O2S/c1-11-14(12-6-8-26-13(10-12)20(4,5)21(22,23)24)32-17(27-11)28-18(31)29-9-7-19(2,3)15(29)16(25)30/h6,8,10,15H,7,9H2,1-5H3,(H2,25,30)(H,27,28,31) |
| InChIKey | YFIYBQUABIIBLO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |