C29H40N2O8Si — CID 75306792
2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6,7-dimethoxy-3-[2-(methoxycarbonylamino)phenyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 75306792) has the molecular formula C29H40N2O8Si and a molecular weight of 572.73 g/mol. Its IUPAC name is 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6,7-dimethoxy-3-[2-(methoxycarbonylamino)phenyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6,7-dimethoxy-3-[2-(methoxycarbonylamino)phenyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 75306792 |
| Molecular Formula | C29H40N2O8Si |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6,7-dimethoxy-3-[2-(methoxycarbonylamino)phenyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | COC(=O)Nc1ccccc1C1C(C(=O)O)c2cc(OC)c(OC)cc2C(=O)N1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H40N2O8Si/c1-29(2,3)40(7,8)39-15-11-14-31-25(18-12-9-10-13-21(18)30-28(35)38-6)24(27(33)34)19-16-22(36-4)23(37-5)17-20(19)26(31)32/h9-10,12-13,16-17,24-25H,11,14-15H2,1-8H3,(H,30,35)(H,33,34) |
| InChIKey | FGXXTORDNXIQCK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|