C27H28N4O7S — CID 75307579
3-(hydroxymethyl)-9-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-13-methyl-4,6,9,13-tetrazapentacyclo[10.7.0.01,5.07,11.014,19]nonadeca-5,7(11),14,16,18-pentaene-8,10-dione (PubChem CID 75307579) has the molecular formula C27H28N4O7S and a molecular weight of 552.61 g/mol. Its IUPAC name is 3-(hydroxymethyl)-9-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-13-methyl-4,6,9,13-tetrazapentacyclo[10.7.0.01,5.07,11.014,19]nonadeca-5,7(11),14,16,18-pentaene-8,10-dione.
| Compound Name | 3-(hydroxymethyl)-9-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-13-methyl-4,6,9,13-tetrazapentacyclo[10.7.0.01,5.07,11.014,19]nonadeca-5,7(11),14,16,18-pentaene-8,10-dione |
|---|---|
| PubChem CID | 75307579 |
| Molecular Formula | C27H28N4O7S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 3-(hydroxymethyl)-9-(2-methoxyethyl)-4-(4-methoxyphenyl)sulfonyl-13-methyl-4,6,9,13-tetrazapentacyclo[10.7.0.01,5.07,11.014,19]nonadeca-5,7(11),14,16,18-pentaene-8,10-dione |
| SMILES | COCCN1C(=O)C2=C(C1=O)C1N(C)c3ccccc3C13CC(CO)N(S(=O)(=O)c1ccc(OC)cc1)C3=N2 |
| InChI | InChI=1S/C27H28N4O7S/c1-29-20-7-5-4-6-19(20)27-14-16(15-32)31(39(35,36)18-10-8-17(38-3)9-11-18)26(27)28-22-21(23(27)29)24(33)30(25(22)34)12-13-37-2/h4-11,16,23,32H,12-15H2,1-3H3 |
| InChIKey | AVUCWUXQFAOVLK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|