C23H26N4O6 — CID 75307607
dimethyl 15-(hydroxymethyl)-8-methyl-14-(prop-2-enylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11-dicarboxylate (PubChem CID 75307607) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is dimethyl 15-(hydroxymethyl)-8-methyl-14-(prop-2-enylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11-dicarboxylate.
| Compound Name | dimethyl 15-(hydroxymethyl)-8-methyl-14-(prop-2-enylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 75307607 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | dimethyl 15-(hydroxymethyl)-8-methyl-14-(prop-2-enylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11-dicarboxylate |
| SMILES | C=CCNC(=O)N1C2=NC(C(=O)OC)=C(C(=O)OC)C3N(C)c4ccccc4C23CC1CO |
| InChI | InChI=1S/C23H26N4O6/c1-5-10-24-22(31)27-13(12-28)11-23-14-8-6-7-9-15(14)26(2)18(23)16(19(29)32-3)17(20(30)33-4)25-21(23)27/h5-9,13,18,28H,1,10-12H2,2-4H3,(H,24,31) |
| InChIKey | DKUBNFALDCGZOI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|