C15H13N5O4 — CID 753077
2-N,6-N-bis(5-methyl-1,2-oxazol-3-yl)pyridine-2,6-dicarboxamide (PubChem CID 753077) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-N,6-N-bis(5-methyl-1,2-oxazol-3-yl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(5-methyl-1,2-oxazol-3-yl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 753077 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-N,6-N-bis(5-methyl-1,2-oxazol-3-yl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(=O)Nc3cc(C)on3)n2)no1 |
| InChI | InChI=1S/C15H13N5O4/c1-8-6-12(19-23-8)17-14(21)10-4-3-5-11(16-10)15(22)18-13-7-9(2)24-20-13/h3-7H,1-2H3,(H,17,19,21)(H,18,20,22) |
| InChIKey | OFSAHSNPZGJTJC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |