C24H25NO4 — CID 75307739
methyl 4-[(2,5-dimethyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate (PubChem CID 75307739) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate.
| Compound Name | methyl 4-[(2,5-dimethyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate |
|---|---|
| PubChem CID | 75307739 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | methyl 4-[(2,5-dimethyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C3(CC(C)=CCC(C)O3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H25NO4/c1-16-8-9-17(2)29-24(14-16)20-6-4-5-7-21(20)25(23(24)27)15-18-10-12-19(13-11-18)22(26)28-3/h4-8,10-13,17H,9,14-15H2,1-3H3 |
| InChIKey | RYTDUGHGAARXLL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|