About methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate
methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate (PubChem CID 75307837) has the molecular formula C23H23NO4
and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate |
| PubChem CID | 75307837 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C3(OCCC=CC3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-16-7-5-6-14-28-23(16)19-8-3-4-9-20(19)24(22(23)26)15-17-10-12-18(13-11-17)21(25)27-2/h3-5,7-13,16H,6,14-15H2,1-2H3 |
| InChIKey | UTZIKVBMSWNQPY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate?
The IUPAC name of methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate (CID 75307837) is methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate.
What is the SMILES notation for methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate?
The canonical SMILES for methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate is COC(=O)c1ccc(CN2C(=O)C3(OCCC=CC3C)c3ccccc32)cc1.
What is the InChIKey of methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate?
The InChIKey is UTZIKVBMSWNQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO4/c1-16-7-5-6-14-28-23(16)19-8-3-4-9-20(19)24(22(23)26)15-17-10-12-18(13-11-17)21(25)27-2/h3-5,7-13,16H,6,14-15H2,1-2H3.
What are the key properties of methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate?
methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate has a molecular weight of 377.44 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(6-methyl-2'-oxospiro[3,6-dihydro-2H-oxepine-7,3'-indole]-1'-yl)methyl]benzoate is sourced from PubChem (CID 75307837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).